cas: 19962-04-0 — see every product listed under this CAS number, including other names
3-Aminophenyl dimethylcarbamate, 97%, 97% (CAS 19962-04-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113C0D-100mg |
| cas | 19962-04-0 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 1g | 467.60 Pln | |
| Chemat | 10g | 2574.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3-aminophenyl) N,N-dimethylcarbamate (CAS 19962-04-0) is a chemical compound with the molecular formula C9H12N2O2 and a molecular weight of 180.20 g/mol. IUPAC name: (3-aminophenyl) N,N-dimethylcarbamate. InChIKey: LKEQZFMJKLCAEA-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O2 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | (3-aminophenyl) N,N-dimethylcarbamate |
| InChIKey | LKEQZFMJKLCAEA-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)OC1=CC=CC(=C1)N |
Computed by PubChem (NCBI)