CAS 1349718-93-9 appears in our catalog under these names: 1-(Cyclobutylmethyl)-1h-pyrazole-4-carboxylic acid, 95%, 1-(Cyclobutylmethyl)-1H-pyrazole-4-carboxylic acid, 98%, 1-(Cyclobutylmethyl)-1H-pyrazole-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 250mg, 50mg, 0,5g.
1-(cyclobutylmethyl)pyrazole-4-carboxylic acid (CAS 1349718-93-9) is a chemical compound with the molecular formula C9H12N2O2 and a molecular weight of 180.20 g/mol. IUPAC name: 1-(cyclobutylmethyl)pyrazole-4-carboxylic acid. InChIKey: IKYYZQPKZYCDHO-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O2 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 1-(cyclobutylmethyl)pyrazole-4-carboxylic acid |
| InChIKey | IKYYZQPKZYCDHO-UHFFFAOYSA-N |
| SMILES | C1CC(C1)CN2C=C(C=N2)C(=O)O |
Computed by PubChem (NCBI)