CAS 19962-04-0 appears in our catalog under these names: 3-Aminophenyl dimethylcarbamate, 95%, 3-Aminophenyl dimethylcarbamate, 97%, 97%, 3-Aminophenyl dimethylcarbamate, 98%, 3-Aminophenyl dimethylcarbamate, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(3-aminophenyl) N,N-dimethylcarbamate (CAS 19962-04-0) is a chemical compound with the molecular formula C9H12N2O2 and a molecular weight of 180.20 g/mol. IUPAC name: (3-aminophenyl) N,N-dimethylcarbamate. InChIKey: LKEQZFMJKLCAEA-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O2 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | (3-aminophenyl) N,N-dimethylcarbamate |
| InChIKey | LKEQZFMJKLCAEA-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)OC1=CC=CC(=C1)N |
Computed by PubChem (NCBI)