CAS 192661-36-2 appears in our catalog under these names: (E)-Ethyl 3-(1-methyl-1H-pyrazol-4-yl)acrylate, 98%, (E)–Ethyl 3–(1–Methyl–1H–Pyrazol–4–Yl)Acrylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg.
Ethyl (E)-3-(1-methylpyrazol-4-yl)prop-2-enoate (CAS 192661-36-2) is a chemical compound with the molecular formula C9H12N2O2 and a molecular weight of 180.20 g/mol. IUPAC name: ethyl (E)-3-(1-methylpyrazol-4-yl)prop-2-enoate. InChIKey: CJNCRTPEAMYZER-SNAWJCMRSA-N.
| Molecular formula | C9H12N2O2 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | ethyl (E)-3-(1-methylpyrazol-4-yl)prop-2-enoate |
| InChIKey | CJNCRTPEAMYZER-SNAWJCMRSA-N |
| SMILES | CCOC(=O)/C=C/C1=CN(N=C1)C |
Computed by PubChem (NCBI)