cas: 1039364-87-8 — see every product listed under this CAS number, including other names
3-BROMO-6-PHENYLPYRAZOLO[1,5-A]PYRIMIDINE, 98% (CAS 1039364-87-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F331928-50MG |
| cas | 1039364-87-8 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 174.96 Pln | |
| Fluorochem | 100mg | 237.43 Pln | |
| Fluorochem | 250mg | 310.33 Pln | |
| Fluorochem | 1g | 732.05 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-bromo-6-phenylpyrazolo[1,5-a]pyrimidine (CAS 1039364-87-8) is a chemical compound with the molecular formula C12H8BrN3 and a molecular weight of 274.12 g/mol. IUPAC name: 3-bromo-6-phenylpyrazolo[1,5-a]pyrimidine. InChIKey: MENYADATKVZLPD-UHFFFAOYSA-N.
| Molecular formula | C12H8BrN3 |
|---|---|
| Molecular weight | 274.12 g/mol |
| IUPAC name | 3-bromo-6-phenylpyrazolo[1,5-a]pyrimidine |
| InChIKey | MENYADATKVZLPD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN3C(=C(C=N3)Br)N=C2 |
Computed by PubChem (NCBI)