3-Benzoylpyridine 98%
cas: 5424-19-1 — see every product listed under this CAS number, including other names
3-Benzoylpyridine 98% (CAS 5424-19-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A132253-1g |
| cas | 5424-19-1 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 225.75 Pln | |
| Ambeed | 10g | 314.75 Pln | |
| Ambeed | 25g | 509.44 Pln | |
| Ambeed | 100g | 1482.88 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A132253 |
Phenyl(pyridin-3-yl)methanone (CAS 5424-19-1) is a chemical compound with the molecular formula C12H9NO and a molecular weight of 183.21 g/mol. IUPAC name: phenyl(pyridin-3-yl)methanone. InChIKey: RYMBAPVTUHZCNF-UHFFFAOYSA-N.
| Molecular formula | C12H9NO |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | phenyl(pyridin-3-yl)methanone |
| InChIKey | RYMBAPVTUHZCNF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CN=CC=C2 |
Computed by PubChem (NCBI)