cas: 193204-22-7 — see every product listed under this CAS number, including other names
3-Benzylpiperidine, HCl, 97%, 97% (CAS 193204-22-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11APEK-100mg |
| cas | 193204-22-7 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 299.60 Pln | |
| Chemat | 250mg | 467.60 Pln | |
| Chemat | 1g | 1173.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-benzylpiperidine;hydrochloride (CAS 193204-22-7) is a chemical compound with the molecular formula C12H18ClN and a molecular weight of 211.73 g/mol. IUPAC name: 3-benzylpiperidine;hydrochloride. InChIKey: FGNRGDZYDGAZBE-UHFFFAOYSA-N.
| Molecular formula | C12H18ClN |
|---|---|
| Molecular weight | 211.73 g/mol |
| IUPAC name | 3-benzylpiperidine;hydrochloride |
| InChIKey | FGNRGDZYDGAZBE-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)CC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)