CAS 1384264-61-2 appears in our catalog under these names: (1-Benzylcyclobutyl)methanamine hydrochloride, 95%, (1-Benzylcyclobutyl)methanamine hydrochloride, 98%, (1-Benzylcyclobutyl)methanamine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 5g, 10g, 1g, 100mg, 0,5g, 50mg.
(1-benzylcyclobutyl)methanamine;hydrochloride (CAS 1384264-61-2) is a chemical compound with the molecular formula C12H18ClN and a molecular weight of 211.73 g/mol. IUPAC name: (1-benzylcyclobutyl)methanamine;hydrochloride. InChIKey: UYKNLZKPZCUNPA-UHFFFAOYSA-N.
| Molecular formula | C12H18ClN |
|---|---|
| Molecular weight | 211.73 g/mol |
| IUPAC name | (1-benzylcyclobutyl)methanamine;hydrochloride |
| InChIKey | UYKNLZKPZCUNPA-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(CC2=CC=CC=C2)CN.Cl |
Computed by PubChem (NCBI)