Products 2250243-80-0
CAS 2250243-80-0 appears in our catalog under these names: 2-(2,6-Dimethylphenyl)pyrrolidine hydrochloride, 95%, 2–(2，6–DIMETHYLPHENYL)PYRROLIDINE HCL. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
2-(2,6-dimethylphenyl)pyrrolidine;hydrochloride (CAS 2250243-80-0) is a chemical compound with the molecular formula C12H18ClN and a molecular weight of 211.73 g/mol. IUPAC name: 2-(2,6-dimethylphenyl)pyrrolidine;hydrochloride. InChIKey: BARCWAPMXCIAHL-UHFFFAOYSA-N.
| Molecular formula | C12H18ClN |
|---|---|
| Molecular weight | 211.73 g/mol |
| IUPAC name | 2-(2,6-dimethylphenyl)pyrrolidine;hydrochloride |
| InChIKey | BARCWAPMXCIAHL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)C2CCCN2.Cl |
Computed by PubChem (NCBI)