CAS 1257535-57-1 is the registry number for N-cyclopropyl 2,4-dimethylbenzylamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
N-[(2,4-dimethylphenyl)methyl]cyclopropanamine;hydrochloride (CAS 1257535-57-1) is a chemical compound with the molecular formula C12H18ClN and a molecular weight of 211.73 g/mol. IUPAC name: N-[(2,4-dimethylphenyl)methyl]cyclopropanamine;hydrochloride. InChIKey: DOCCZMIRRYJWKT-UHFFFAOYSA-N.
| Molecular formula | C12H18ClN |
|---|---|
| Molecular weight | 211.73 g/mol |
| IUPAC name | N-[(2,4-dimethylphenyl)methyl]cyclopropanamine;hydrochloride |
| InChIKey | DOCCZMIRRYJWKT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)CNC2CC2)C.Cl |
Computed by PubChem (NCBI)