Products 50451-89-3
CAS 50451-89-3 is the registry number for 2-Bromobenzo[b]thiophene-3-carboxylic acid, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g.
2-bromo-1-benzothiophene-3-carboxylic acid (CAS 50451-89-3) is a chemical compound with the molecular formula C9H5BrO2S and a molecular weight of 257.11 g/mol. IUPAC name: 2-bromo-1-benzothiophene-3-carboxylic acid. InChIKey: MGNSSFGSAJGIBM-UHFFFAOYSA-N.
| Molecular formula | C9H5BrO2S |
|---|---|
| Molecular weight | 257.11 g/mol |
| IUPAC name | 2-bromo-1-benzothiophene-3-carboxylic acid |
| InChIKey | MGNSSFGSAJGIBM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(S2)Br)C(=O)O |
Computed by PubChem (NCBI)