CAS 19075-61-7 appears in our catalog under these names: 6-Bromobenzo(b)thiophene-3-carboxylic acid, 98%, 6-Bromobenzo[b]thiophene-3-carboxylic acid, 98%, 6-Bromobenzo[b]thiophene-3-carboxylic acid, 95%. Offered by: AmBeed, Fluorochem, Chemat, BLDpharm. Available pack sizes: 5g, 100mg, 250mg, 50mg, 1g.
6-bromo-1-benzothiophene-3-carboxylic acid (CAS 19075-61-7) is a chemical compound with the molecular formula C9H5BrO2S and a molecular weight of 257.11 g/mol. IUPAC name: 6-bromo-1-benzothiophene-3-carboxylic acid. InChIKey: ZXMDECZLLPFSJO-UHFFFAOYSA-N.
| Molecular formula | C9H5BrO2S |
|---|---|
| Molecular weight | 257.11 g/mol |
| IUPAC name | 6-bromo-1-benzothiophene-3-carboxylic acid |
| InChIKey | ZXMDECZLLPFSJO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)SC=C2C(=O)O |
Computed by PubChem (NCBI)