CAS 1013-83-8 appears in our catalog under these names: 5-Bromo-2-naphthoic acid 95%, 5-Bromo-2-naphthoic acid, 97%, 97%, 5-Bromo-2-naphthoic acid, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 500g, 250mg, 1g, 5g, 10g, 25g, 100g, 100mg.
5-bromonaphthalene-2-carboxylic acid (CAS 1013-83-8) is a chemical compound with the molecular formula C11H7BrO2 and a molecular weight of 251.08 g/mol. IUPAC name: 5-bromonaphthalene-2-carboxylic acid. InChIKey: QPOQPJDDJJNVRY-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO2 |
|---|---|
| Molecular weight | 251.08 g/mol |
| IUPAC name | 5-bromonaphthalene-2-carboxylic acid |
| InChIKey | QPOQPJDDJJNVRY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)C(=O)O)C(=C1)Br |
Computed by PubChem (NCBI)