Products 1729-99-3
CAS 1729-99-3 appears in our catalog under these names: 8–Bromo–1–naphthoic acid, 8-bromonaphthalene-1-carboxylic acid, 8-Bromo-1-naphthoic acid, Tech , 8-Bromo-1-naphthoic acid 95%, 8-Bromo-1-naphthoic acid, 97%, 97%. Offered by: GLPBio, Biosynth, Thermo Scientific, Ambeed, Chemat. Available pack sizes: 10g, 1g, 5g, 2,5g, 25g, 250mg, 100g, 50g.
8-bromonaphthalene-1-carboxylic acid (CAS 1729-99-3) is a chemical compound with the molecular formula C11H7BrO2 and a molecular weight of 251.08 g/mol. IUPAC name: 8-bromonaphthalene-1-carboxylic acid. InChIKey: DMEZDDHJCUHENA-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO2 |
|---|---|
| Molecular weight | 251.08 g/mol |
| IUPAC name | 8-bromonaphthalene-1-carboxylic acid |
| InChIKey | DMEZDDHJCUHENA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)C(=O)O)C(=CC=C2)Br |
Computed by PubChem (NCBI)