cas: 1049706-73-1 — see every product listed under this CAS number, including other names
3-Bromo-2-chloro-4-methyl-5-nitropyridine, 98% (CAS 1049706-73-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 250mg, 500mg, 2.5g, 10g, 25g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | LD-1303-5g |
| cas | 1049706-73-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 500mg | 247.85 Pln | |
| Fluorochem | 1g | 268.67 Pln | |
| Fluorochem | 2.5g | 591.48 Pln | |
| Fluorochem | 5g | 784.12 Pln | |
| Fluorochem | 10g | 1502.61 Pln | |
| Fluorochem | 25g | 3668.52 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
3-bromo-2-chloro-4-methyl-5-nitropyridine (CAS 1049706-73-1) is a chemical compound with the molecular formula C6H4BrClN2O2 and a molecular weight of 251.46 g/mol. IUPAC name: 3-bromo-2-chloro-4-methyl-5-nitropyridine. InChIKey: QGEFBUJRBVNTFX-UHFFFAOYSA-N.
| Molecular formula | C6H4BrClN2O2 |
|---|---|
| Molecular weight | 251.46 g/mol |
| IUPAC name | 3-bromo-2-chloro-4-methyl-5-nitropyridine |
| InChIKey | QGEFBUJRBVNTFX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC=C1[N+](=O)[O-])Cl)Br |
Computed by PubChem (NCBI)