CAS 856834-95-2 appears in our catalog under these names: 3-Bromo-2-chloro-6-methyl-5-nitropyridine 98%, 3-Bromo-2-chloro-6-methyl-5-nitropyridine, 98%. Offered by: Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g.
3-bromo-2-chloro-6-methyl-5-nitropyridine (CAS 856834-95-2) is a chemical compound with the molecular formula C6H4BrClN2O2 and a molecular weight of 251.46 g/mol. IUPAC name: 3-bromo-2-chloro-6-methyl-5-nitropyridine. InChIKey: WKGHUAZJNBXABN-UHFFFAOYSA-N.
| Molecular formula | C6H4BrClN2O2 |
|---|---|
| Molecular weight | 251.46 g/mol |
| IUPAC name | 3-bromo-2-chloro-6-methyl-5-nitropyridine |
| InChIKey | WKGHUAZJNBXABN-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(C=C1[N+](=O)[O-])Br)Cl |
Computed by PubChem (NCBI)