cas: 1214323-32-6 — see every product listed under this CAS number, including other names
3-Bromo-2-chloroisonicotinic acid, 95% (CAS 1214323-32-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F620954-100MG |
| cas | 1214323-32-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 128.10 Pln | |
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 232.23 Pln | |
| Fluorochem | 5g | 950.72 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-bromo-2-chloropyridine-4-carboxylic acid (CAS 1214323-32-6) is a chemical compound with the molecular formula C6H3BrClNO2 and a molecular weight of 236.45 g/mol. IUPAC name: 3-bromo-2-chloropyridine-4-carboxylic acid. InChIKey: CBDQVZVCRLQAOD-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClNO2 |
|---|---|
| Molecular weight | 236.45 g/mol |
| IUPAC name | 3-bromo-2-chloropyridine-4-carboxylic acid |
| InChIKey | CBDQVZVCRLQAOD-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1C(=O)O)Br)Cl |
Computed by PubChem (NCBI)