cas: 161957-56-8 — see every product listed under this CAS number, including other names
3-Bromo-2-fluorobenzoic acid, 95% (CAS 161957-56-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F005473-1G |
| cas | 161957-56-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 81.24 Pln | |
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 10g | 128.10 Pln | |
| Fluorochem | 25g | 195.78 Pln | |
| Fluorochem | 100g | 502.97 Pln | |
| Fluorochem | 250g | 1174.60 Pln | |
| Fluorochem | 500g | 2200.28 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
3-bromo-2-fluorobenzoic acid (CAS 161957-56-8) is a chemical compound with the molecular formula C7H4BrFO2 and a molecular weight of 219.01 g/mol. IUPAC name: 3-bromo-2-fluorobenzoic acid. InChIKey: UVKURTLVTLRSSM-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFO2 |
|---|---|
| Molecular weight | 219.01 g/mol |
| IUPAC name | 3-bromo-2-fluorobenzoic acid |
| InChIKey | UVKURTLVTLRSSM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)F)C(=O)O |
Computed by PubChem (NCBI)