cas: 161957-56-8 — see every product listed under this CAS number, including other names
3-Bromo-2-fluorobenzoic acid, 98%, 98% (CAS 161957-56-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112SK5-1g |
| cas | 161957-56-8 |
| size | 1g |
| availability | 135g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 69.20 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 141.20 Pln | |
| Chemat | 100g | 386.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-bromo-2-fluorobenzoic acid (CAS 161957-56-8) is a chemical compound with the molecular formula C7H4BrFO2 and a molecular weight of 219.01 g/mol. IUPAC name: 3-bromo-2-fluorobenzoic acid. InChIKey: UVKURTLVTLRSSM-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFO2 |
|---|---|
| Molecular weight | 219.01 g/mol |
| IUPAC name | 3-bromo-2-fluorobenzoic acid |
| InChIKey | UVKURTLVTLRSSM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)F)C(=O)O |
Computed by PubChem (NCBI)