cas: 3883-95-2 — see every product listed under this CAS number, including other names
3-Bromo-2-hydroxybenzoic acid 98% (CAS 3883-95-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A362033-250mg |
| cas | 3883-95-2 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 242.44 Pln | |
| Ambeed | 10g | 409.31 Pln | |
| Ambeed | 25g | 748.62 Pln | |
| Ambeed | 100g | 2428.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A362033 |
3-bromo-2-hydroxybenzoic acid (CAS 3883-95-2) is a chemical compound with the molecular formula C7H5BrO3 and a molecular weight of 217.02 g/mol. IUPAC name: 3-bromo-2-hydroxybenzoic acid. InChIKey: BHPSQWRVKOPSOQ-UHFFFAOYSA-N.
| Molecular formula | C7H5BrO3 |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | 3-bromo-2-hydroxybenzoic acid |
| InChIKey | BHPSQWRVKOPSOQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)O)C(=O)O |
Computed by PubChem (NCBI)