CAS 3883-95-2 appears in our catalog under these names: 3-Bromo-2-hydroxybenzoic Acid, 3-Bromo-2-hydroxybenzoic acid 98%, 3-Bromo-2-hydroxybenzoic acid, 96%, 3-Bromo-2-hydroxybenzoic acid, 98%, 98%, 3-Bromosalicylic acid. Offered by: TRC, Ambeed, Fluorochem, Chemat, Biosynth. Available pack sizes: 1g, 25g, 5g, 250mg, 10g, 100g, 2g, 50g.
3-bromo-2-hydroxybenzoic acid (CAS 3883-95-2) is a chemical compound with the molecular formula C7H5BrO3 and a molecular weight of 217.02 g/mol. IUPAC name: 3-bromo-2-hydroxybenzoic acid. InChIKey: BHPSQWRVKOPSOQ-UHFFFAOYSA-N.
| Molecular formula | C7H5BrO3 |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | 3-bromo-2-hydroxybenzoic acid |
| InChIKey | BHPSQWRVKOPSOQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)O)C(=O)O |
Computed by PubChem (NCBI)