cas: 2223051-53-2 — see every product listed under this CAS number, including other names
3-Bromo-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 96%, 96% (CAS 2223051-53-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11JN23-250mg |
| cas | 2223051-53-2 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 294.80 Pln | |
| Chemat | 1g | 683.60 Pln | |
| Chemat | 100mg | 198.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
3-bromo-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2223051-53-2) is a chemical compound with the molecular formula C12H17BBrNO2 and a molecular weight of 297.99 g/mol. IUPAC name: 3-bromo-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: CWUAYBIJFGBNEM-UHFFFAOYSA-N.
| Molecular formula | C12H17BBrNO2 |
|---|---|
| Molecular weight | 297.99 g/mol |
| IUPAC name | 3-bromo-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | CWUAYBIJFGBNEM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(N=C2)C)Br |
Computed by PubChem (NCBI)