CAS 2225180-91-4 is the registry number for 2–Bromo–4–(4–methylpiperidin–1–yl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 10mg, 25mg.
[2-bromo-4-(4-methylpiperidin-1-yl)phenyl]boronic acid (CAS 2225180-91-4) is a chemical compound with the molecular formula C12H17BBrNO2 and a molecular weight of 297.99 g/mol. IUPAC name: [2-bromo-4-(4-methylpiperidin-1-yl)phenyl]boronic acid. InChIKey: SICUASYAUJCYSL-UHFFFAOYSA-N.
| Molecular formula | C12H17BBrNO2 |
|---|---|
| Molecular weight | 297.99 g/mol |
| IUPAC name | [2-bromo-4-(4-methylpiperidin-1-yl)phenyl]boronic acid |
| InChIKey | SICUASYAUJCYSL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)N2CCC(CC2)C)Br)(O)O |
Computed by PubChem (NCBI)