cas: 2057523-47-2 — see every product listed under this CAS number, including other names
3-Bromo-2-methylphenylboronic acid pinacol ester, 98%, 98% (CAS 2057523-47-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12K72I-100mg |
| cas | 2057523-47-2 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 266.00 Pln | |
| Chemat | 1g | 630.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(3-bromo-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2057523-47-2) is a chemical compound with the molecular formula C13H18BBrO2 and a molecular weight of 297.00 g/mol. IUPAC name: 2-(3-bromo-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: QBKJTENBXNNKBN-UHFFFAOYSA-N.
| Molecular formula | C13H18BBrO2 |
|---|---|
| Molecular weight | 297.00 g/mol |
| IUPAC name | 2-(3-bromo-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | QBKJTENBXNNKBN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)Br)C |
Computed by PubChem (NCBI)