cas: 904814-72-8 — see every product listed under this CAS number, including other names
3-Bromo-2-phenylimidazo[1,2-a]pyrimidine (CAS 904814-72-8) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GVBR-25mg |
| cas | 904814-72-8 |
| size | 25mg |
| availability | 0.1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 395.60 Pln | |
| Chemat | 100mg | 1024.40 Pln |
| delivery time | 3 weeks |
|---|
3-bromo-2-phenylimidazo[1,2-a]pyrimidine (CAS 904814-72-8) is a chemical compound with the molecular formula C12H8BrN3 and a molecular weight of 274.12 g/mol. IUPAC name: 3-bromo-2-phenylimidazo[1,2-a]pyrimidine. InChIKey: ADGMBHUSGZGHTE-UHFFFAOYSA-N.
| Molecular formula | C12H8BrN3 |
|---|---|
| Molecular weight | 274.12 g/mol |
| IUPAC name | 3-bromo-2-phenylimidazo[1,2-a]pyrimidine |
| InChIKey | ADGMBHUSGZGHTE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N3C=CC=NC3=N2)Br |
Computed by PubChem (NCBI)