cas: 443777-03-5 — see every product listed under this CAS number, including other names
3-Bromo-4-(4-methylpiperazin-1-yl)benzaldehyde (CAS 443777-03-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F720784-250MG |
| cas | 443777-03-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 419.66 Pln | |
| Fluorochem | 5g | 2939.61 Pln |
| delivery time | 3-4 weeks |
|---|
3-bromo-4-(4-methylpiperazin-1-yl)benzaldehyde (CAS 443777-03-5) is a chemical compound with the molecular formula C12H15BrN2O and a molecular weight of 283.16 g/mol. IUPAC name: 3-bromo-4-(4-methylpiperazin-1-yl)benzaldehyde. InChIKey: SBYCBJFPQHUWDY-UHFFFAOYSA-N.
| Molecular formula | C12H15BrN2O |
|---|---|
| Molecular weight | 283.16 g/mol |
| IUPAC name | 3-bromo-4-(4-methylpiperazin-1-yl)benzaldehyde |
| InChIKey | SBYCBJFPQHUWDY-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=C(C=C(C=C2)C=O)Br |
Computed by PubChem (NCBI)