CAS 678996-43-5 appears in our catalog under these names: 1-[4-(4-bromophenyl)piperazin-1-yl]ethanone, 98%, 1–(4–(4–bromophenyl)piperazin–1–yl)ethanone, 1-(4-(4-bromophenyl)piperazin-1-yl)ethanone. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 1g, 5g, 250mg, 500mg, 1000mg, 2000mg, 5000mg.
1-[4-(4-bromophenyl)piperazin-1-yl]ethanone (CAS 678996-43-5) is a chemical compound with the molecular formula C12H15BrN2O and a molecular weight of 283.16 g/mol. IUPAC name: 1-[4-(4-bromophenyl)piperazin-1-yl]ethanone. InChIKey: WNWHREPVSZJEPA-UHFFFAOYSA-N.
| Molecular formula | C12H15BrN2O |
|---|---|
| Molecular weight | 283.16 g/mol |
| IUPAC name | 1-[4-(4-bromophenyl)piperazin-1-yl]ethanone |
| InChIKey | WNWHREPVSZJEPA-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCN(CC1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)