CAS 109607-56-9 is the registry number for 1-(4-Bromophenyl)-2-(piperazin-1-yl)ethanone, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
1-(4-bromophenyl)-2-piperazin-1-ylethanone (CAS 109607-56-9) is a chemical compound with the molecular formula C12H15BrN2O and a molecular weight of 283.16 g/mol. IUPAC name: 1-(4-bromophenyl)-2-piperazin-1-ylethanone. InChIKey: NOYCWKDPKBQIKR-UHFFFAOYSA-N.
| Molecular formula | C12H15BrN2O |
|---|---|
| Molecular weight | 283.16 g/mol |
| IUPAC name | 1-(4-bromophenyl)-2-piperazin-1-ylethanone |
| InChIKey | NOYCWKDPKBQIKR-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)