CAS 60465-16-9 is the registry number for Piperidine-1-carboxylic acid (3-bromo-phenyl)-amide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
N-(3-bromophenyl)piperidine-1-carboxamide (CAS 60465-16-9) is a chemical compound with the molecular formula C12H15BrN2O and a molecular weight of 283.16 g/mol. IUPAC name: N-(3-bromophenyl)piperidine-1-carboxamide. InChIKey: KBONEZFRFNOEGQ-UHFFFAOYSA-N.
| Molecular formula | C12H15BrN2O |
|---|---|
| Molecular weight | 283.16 g/mol |
| IUPAC name | N-(3-bromophenyl)piperidine-1-carboxamide |
| InChIKey | KBONEZFRFNOEGQ-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)NC2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)