cas: 58244-42-1 — see every product listed under this CAS number, including other names
3-Bromo-4-ethoxynitrobenzene 98% (CAS 58244-42-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A749354-5g |
| cas | 58244-42-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 209.06 Pln | |
| Ambeed | 25g | 531.69 Pln | |
| Ambeed | 100g | 1455.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A749354 |
2-bromo-1-ethoxy-4-nitrobenzene (CAS 58244-42-1) is a chemical compound with the molecular formula C8H8BrNO3 and a molecular weight of 246.06 g/mol. IUPAC name: 2-bromo-1-ethoxy-4-nitrobenzene. InChIKey: DAJMJBJIPXARBJ-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO3 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | 2-bromo-1-ethoxy-4-nitrobenzene |
| InChIKey | DAJMJBJIPXARBJ-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)