cas: 58244-42-1 — see every product listed under this CAS number, including other names
3-Bromo-4-ethoxynitrobenzene (CAS 58244-42-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F038809-1G |
| cas | 58244-42-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 253.05 Pln | |
| Fluorochem | 5g | 383.22 Pln | |
| Fluorochem | 25g | 1127.75 Pln |
| delivery time | 3-4 weeks |
|---|
2-bromo-1-ethoxy-4-nitrobenzene (CAS 58244-42-1) is a chemical compound with the molecular formula C8H8BrNO3 and a molecular weight of 246.06 g/mol. IUPAC name: 2-bromo-1-ethoxy-4-nitrobenzene. InChIKey: DAJMJBJIPXARBJ-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO3 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | 2-bromo-1-ethoxy-4-nitrobenzene |
| InChIKey | DAJMJBJIPXARBJ-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)