cas: 1187932-53-1 — see every product listed under this CAS number, including other names
3-Bromo-5,6,7,8-tetrahydro-1,6-naphthyridine dihydrochloride, 97% (CAS 1187932-53-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 10g, 100mg, 250mg, 500mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A539599-5g |
| cas | 1187932-53-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 12452.02 Pln | |
| AmBeed | 1g | 4190.83 Pln | |
| AmBeed | 10g | 20700.19 Pln | |
| Fluorochem | 100mg | 1278.73 Pln | |
| Fluorochem | 250mg | 2080.54 Pln | |
| Fluorochem | 500mg | 2955.23 Pln | |
| Fluorochem | 1g | 4376.60 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-bromo-5,6,7,8-tetrahydro-1,6-naphthyridine;dihydrochloride (CAS 1187932-53-1) is a chemical compound with the molecular formula C8H11BrCl2N2 and a molecular weight of 285.99 g/mol. IUPAC name: 3-bromo-5,6,7,8-tetrahydro-1,6-naphthyridine;dihydrochloride. InChIKey: OWWMQONBAXDTPI-UHFFFAOYSA-N.
| Molecular formula | C8H11BrCl2N2 |
|---|---|
| Molecular weight | 285.99 g/mol |
| IUPAC name | 3-bromo-5,6,7,8-tetrahydro-1,6-naphthyridine;dihydrochloride |
| InChIKey | OWWMQONBAXDTPI-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1N=CC(=C2)Br.Cl.Cl |
Computed by PubChem (NCBI)