cas: 1187932-53-1 — see every product listed under this CAS number, including other names
3-bromo-5,6,7,8-tetrahydro-1,6-naphthyridine dihydrochloride, 97%, 97% (CAS 1187932-53-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1103H4-100mg |
| cas | 1187932-53-1 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 789.20 Pln | |
| Chemat | 250mg | 1274.00 Pln | |
| Chemat | 500mg | 1802.00 Pln | |
| Chemat | 1g | 2656.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-bromo-5,6,7,8-tetrahydro-1,6-naphthyridine;dihydrochloride (CAS 1187932-53-1) is a chemical compound with the molecular formula C8H11BrCl2N2 and a molecular weight of 285.99 g/mol. IUPAC name: 3-bromo-5,6,7,8-tetrahydro-1,6-naphthyridine;dihydrochloride. InChIKey: OWWMQONBAXDTPI-UHFFFAOYSA-N.
| Molecular formula | C8H11BrCl2N2 |
|---|---|
| Molecular weight | 285.99 g/mol |
| IUPAC name | 3-bromo-5,6,7,8-tetrahydro-1,6-naphthyridine;dihydrochloride |
| InChIKey | OWWMQONBAXDTPI-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1N=CC(=C2)Br.Cl.Cl |
Computed by PubChem (NCBI)