cas: 2096333-90-1 — see every product listed under this CAS number, including other names
3-Bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 98% (CAS 2096333-90-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A854214-5g |
| cas | 2096333-90-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 408.52 Pln | |
| AmBeed | 25g | 1424.08 Pln | |
| AmBeed | 1g | 200.20 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 2096333-90-1) is a chemical compound with the molecular formula C13H16BBrO4 and a molecular weight of 326.98 g/mol. IUPAC name: 3-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: SMJHVOLVWQZJPP-UHFFFAOYSA-N.
| Molecular formula | C13H16BBrO4 |
|---|---|
| Molecular weight | 326.98 g/mol |
| IUPAC name | 3-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | SMJHVOLVWQZJPP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)Br)C(=O)O |
Computed by PubChem (NCBI)