CAS 2121514-16-5 appears in our catalog under these names: 5-Bromobenzo[1,3]dioxole-4-boronic acid pinacol ester, 97%, 2-(5-Bromobenzo(d)(1,3)dioxol-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 100g, 10g, 1g, 5g.
2-(5-bromo-1,3-benzodioxol-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121514-16-5) is a chemical compound with the molecular formula C13H16BBrO4 and a molecular weight of 326.98 g/mol. IUPAC name: 2-(5-bromo-1,3-benzodioxol-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: XTPUSDMNTHXJAW-UHFFFAOYSA-N.
| Molecular formula | C13H16BBrO4 |
|---|---|
| Molecular weight | 326.98 g/mol |
| IUPAC name | 2-(5-bromo-1,3-benzodioxol-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | XTPUSDMNTHXJAW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC3=C2OCO3)Br |
Computed by PubChem (NCBI)