CAS 2096333-90-1 appears in our catalog under these names: 3-Bromo-5-carboxyphenylboronic acid, pinacol ester, 98%, 3-Bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 100g, 5g, 1g.
3-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 2096333-90-1) is a chemical compound with the molecular formula C13H16BBrO4 and a molecular weight of 326.98 g/mol. IUPAC name: 3-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: SMJHVOLVWQZJPP-UHFFFAOYSA-N.
| Molecular formula | C13H16BBrO4 |
|---|---|
| Molecular weight | 326.98 g/mol |
| IUPAC name | 3-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | SMJHVOLVWQZJPP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)Br)C(=O)O |
Computed by PubChem (NCBI)