CAS 1150271-54-7 appears in our catalog under these names: 5-Bromo-2,3-methylenedioxyphenylboronic acid pinacol ester, 98%, 2-(6-Bromobenzo[d][1,3]dioxol-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 1g, 250mg, 25g.
2-(6-bromo-1,3-benzodioxol-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1150271-54-7) is a chemical compound with the molecular formula C13H16BBrO4 and a molecular weight of 326.98 g/mol. IUPAC name: 2-(6-bromo-1,3-benzodioxol-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: HWZKYYFZYKNIQJ-UHFFFAOYSA-N.
| Molecular formula | C13H16BBrO4 |
|---|---|
| Molecular weight | 326.98 g/mol |
| IUPAC name | 2-(6-bromo-1,3-benzodioxol-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | HWZKYYFZYKNIQJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC3=C2OCO3)Br |
Computed by PubChem (NCBI)