cas: 914636-35-4 — see every product listed under this CAS number, including other names
3-Bromo-5-(trifluoromethoxy)aniline 99% (CAS 914636-35-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A347611-1g |
| cas | 914636-35-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 743.06 Pln | |
| Ambeed | 10g | 1310.44 Pln | |
| Ambeed | 25g | 2979.19 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A347611 |
3-bromo-5-(trifluoromethoxy)aniline (CAS 914636-35-4) is a chemical compound with the molecular formula C7H5BrF3NO and a molecular weight of 256.02 g/mol. IUPAC name: 3-bromo-5-(trifluoromethoxy)aniline. InChIKey: GJUHRBPRJGNGFH-UHFFFAOYSA-N.
| Molecular formula | C7H5BrF3NO |
|---|---|
| Molecular weight | 256.02 g/mol |
| IUPAC name | 3-bromo-5-(trifluoromethoxy)aniline |
| InChIKey | GJUHRBPRJGNGFH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1OC(F)(F)F)Br)N |
Computed by PubChem (NCBI)