cas: 112930-39-9 — see every product listed under this CAS number, including other names
3-Bromo-5-isopropylbenzoic acid, 96%, 96% (CAS 112930-39-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11476U-100mg |
| cas | 112930-39-9 |
| size | 100mg |
| availability | 50g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 500mg | 155.60 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 856.40 Pln | |
| Chemat | 10g | 1485.20 Pln | |
| Chemat | 25g | 3626.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
3-bromo-5-propan-2-ylbenzoic acid (CAS 112930-39-9) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: 3-bromo-5-propan-2-ylbenzoic acid. InChIKey: SRTKNJYXJIAPIR-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | 3-bromo-5-propan-2-ylbenzoic acid |
| InChIKey | SRTKNJYXJIAPIR-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1)Br)C(=O)O |
Computed by PubChem (NCBI)