cas: 78156-39-5 — see every product listed under this CAS number, including other names
3-Bromo-5-methoxypyridine 1-oxide, 98+% (CAS 78156-39-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A946629-5g |
| cas | 78156-39-5 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 5909.47 Pln | |
| AmBeed | 10g | 10225.60 Pln | |
| AmBeed | 25g | 20381.20 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-bromo-5-methoxy-1-oxidopyridin-1-ium (CAS 78156-39-5) is a chemical compound with the molecular formula C6H6BrNO2 and a molecular weight of 204.02 g/mol. IUPAC name: 3-bromo-5-methoxy-1-oxidopyridin-1-ium. InChIKey: KHOPHTRZCOJGRR-UHFFFAOYSA-N.
| Molecular formula | C6H6BrNO2 |
|---|---|
| Molecular weight | 204.02 g/mol |
| IUPAC name | 3-bromo-5-methoxy-1-oxidopyridin-1-ium |
| InChIKey | KHOPHTRZCOJGRR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C[N+](=C1)[O-])Br |
Computed by PubChem (NCBI)