Products 78156-39-5
CAS 78156-39-5 appears in our catalog under these names: 3-Bromo-5-methoxypyridine 1-oxide, 3-Bromo-5-methoxypyridine 1-oxide, 95%, 3-Bromo-5-methoxypyridine 1-oxide, 98+%, Pyridine，3–bromo–5–methoxy–， 1–oxide. Offered by: Fluorochem, Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 1g, 25g, 10g, 250mg, 500mg.
3-bromo-5-methoxy-1-oxidopyridin-1-ium (CAS 78156-39-5) is a chemical compound with the molecular formula C6H6BrNO2 and a molecular weight of 204.02 g/mol. IUPAC name: 3-bromo-5-methoxy-1-oxidopyridin-1-ium. InChIKey: KHOPHTRZCOJGRR-UHFFFAOYSA-N.
| Molecular formula | C6H6BrNO2 |
|---|---|
| Molecular weight | 204.02 g/mol |
| IUPAC name | 3-bromo-5-methoxy-1-oxidopyridin-1-ium |
| InChIKey | KHOPHTRZCOJGRR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C[N+](=C1)[O-])Br |
Computed by PubChem (NCBI)