CAS 1305322-98-8 is the registry number for 2-Bromo-5-methoxypyridine 1-oxide, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-bromo-5-methoxy-1-oxidopyridin-1-ium (CAS 1305322-98-8) is a chemical compound with the molecular formula C6H6BrNO2 and a molecular weight of 204.02 g/mol. IUPAC name: 2-bromo-5-methoxy-1-oxidopyridin-1-ium. InChIKey: RWLBKECCSXLSJX-UHFFFAOYSA-N.
| Molecular formula | C6H6BrNO2 |
|---|---|
| Molecular weight | 204.02 g/mol |
| IUPAC name | 2-bromo-5-methoxy-1-oxidopyridin-1-ium |
| InChIKey | RWLBKECCSXLSJX-UHFFFAOYSA-N |
| SMILES | COC1=C[N+](=C(C=C1)Br)[O-] |
Computed by PubChem (NCBI)