CAS 104819-48-9 appears in our catalog under these names: 2-Bromo-3-methoxypyridine-n-oxide, 95%, Pyridine,2-bromo-3-methoxy-, 1-oxide, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 1g, 250mg, 10mg.
2-bromo-3-methoxy-1-oxidopyridin-1-ium (CAS 104819-48-9) is a chemical compound with the molecular formula C6H6BrNO2 and a molecular weight of 204.02 g/mol. IUPAC name: 2-bromo-3-methoxy-1-oxidopyridin-1-ium. InChIKey: HZSVGYDULFVJAB-UHFFFAOYSA-N.
| Molecular formula | C6H6BrNO2 |
|---|---|
| Molecular weight | 204.02 g/mol |
| IUPAC name | 2-bromo-3-methoxy-1-oxidopyridin-1-ium |
| InChIKey | HZSVGYDULFVJAB-UHFFFAOYSA-N |
| SMILES | COC1=C([N+](=CC=C1)[O-])Br |
Computed by PubChem (NCBI)