cas: 1065074-81-8 — see every product listed under this CAS number, including other names
3-Bromo-5-nitro-2-(pyrrolidin-1-yl)pyridine (CAS 1065074-81-8) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch119SUA-1g |
| cas | 1065074-81-8 |
| size | 1g |
| availability | 16.29g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1461.20 Pln | |
| Fluorochem | 1g | 2392.93 Pln |
| delivery time | 3 weeks |
|---|
3-bromo-5-nitro-2-pyrrolidin-1-ylpyridine (CAS 1065074-81-8) is a chemical compound with the molecular formula C9H10BrN3O2 and a molecular weight of 272.10 g/mol. IUPAC name: 3-bromo-5-nitro-2-pyrrolidin-1-ylpyridine. InChIKey: YZDNWQJSPBAYQY-UHFFFAOYSA-N.
| Molecular formula | C9H10BrN3O2 |
|---|---|
| Molecular weight | 272.10 g/mol |
| IUPAC name | 3-bromo-5-nitro-2-pyrrolidin-1-ylpyridine |
| InChIKey | YZDNWQJSPBAYQY-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=C(C=C(C=N2)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)