cas: 186413-75-2 — see every product listed under this CAS number, including other names
3-Bromo-6-chloro-2-methyl-5-nitropyridine 97% (CAS 186413-75-2) is a chemical reagent available from Chemat. Available pack sizes: 500g, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A323170-500g |
| cas | 186413-75-2 |
| size | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 10082.50 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 275.81 Pln | |
| Ambeed | 10g | 431.56 Pln | |
| Ambeed | 25g | 876.56 Pln | |
| Ambeed | 100g | 2573.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A323170 |
5-bromo-2-chloro-6-methyl-3-nitropyridine (CAS 186413-75-2) is a chemical compound with the molecular formula C6H4BrClN2O2 and a molecular weight of 251.46 g/mol. IUPAC name: 5-bromo-2-chloro-6-methyl-3-nitropyridine. InChIKey: PVECCSKVOZZRPC-UHFFFAOYSA-N.
| Molecular formula | C6H4BrClN2O2 |
|---|---|
| Molecular weight | 251.46 g/mol |
| IUPAC name | 5-bromo-2-chloro-6-methyl-3-nitropyridine |
| InChIKey | PVECCSKVOZZRPC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=N1)Cl)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)