cas: 944906-48-3 — see every product listed under this CAS number, including other names
3-Bromo-6-chloroimidazo[1,2-a]pyrimidine 97% (CAS 944906-48-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A286552-100mg |
| cas | 944906-48-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 259.12 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 698.56 Pln | |
| Ambeed | 5g | 2534.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A286552 |
3-bromo-6-chloroimidazo[1,2-a]pyrimidine (CAS 944906-48-3) is a chemical compound with the molecular formula C6H3BrClN3 and a molecular weight of 232.46 g/mol. IUPAC name: 3-bromo-6-chloroimidazo[1,2-a]pyrimidine. InChIKey: ZNNVAIVBZLXARY-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClN3 |
|---|---|
| Molecular weight | 232.46 g/mol |
| IUPAC name | 3-bromo-6-chloroimidazo[1,2-a]pyrimidine |
| InChIKey | ZNNVAIVBZLXARY-UHFFFAOYSA-N |
| SMILES | C1=C(N2C=C(C=NC2=N1)Cl)Br |
Computed by PubChem (NCBI)