cas: 944906-48-3 — see every product listed under this CAS number, including other names
3-Bromo-6-chloroimidazo[1,2-a]pyrimidine, 97%, 97% (CAS 944906-48-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IIAE-100mg |
| cas | 944906-48-3 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 261.20 Pln | |
| Chemat | 1g | 597.20 Pln | |
| Chemat | 5g | 1936.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-bromo-6-chloroimidazo[1,2-a]pyrimidine (CAS 944906-48-3) is a chemical compound with the molecular formula C6H3BrClN3 and a molecular weight of 232.46 g/mol. IUPAC name: 3-bromo-6-chloroimidazo[1,2-a]pyrimidine. InChIKey: ZNNVAIVBZLXARY-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClN3 |
|---|---|
| Molecular weight | 232.46 g/mol |
| IUPAC name | 3-bromo-6-chloroimidazo[1,2-a]pyrimidine |
| InChIKey | ZNNVAIVBZLXARY-UHFFFAOYSA-N |
| SMILES | C1=C(N2C=C(C=NC2=N1)Cl)Br |
Computed by PubChem (NCBI)