cas: 871269-11-3 — see every product listed under this CAS number, including other names
3-Bromo-N,N-diethylbenzenesulfonamide, 98% (CAS 871269-11-3) is a chemical reagent available from Chemat. Available pack sizes: 500g, 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A822818-500g |
| cas | 871269-11-3 |
| size | 500g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 500g | 6213.36 Pln | |
| AmBeed | 1g | 154.63 Pln | |
| AmBeed | 5g | 239.26 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-bromo-N,N-diethylbenzenesulfonamide (CAS 871269-11-3) is a chemical compound with the molecular formula C10H14BrNO2S and a molecular weight of 292.19 g/mol. IUPAC name: 3-bromo-N,N-diethylbenzenesulfonamide. InChIKey: ZELYQSZTABGDLA-UHFFFAOYSA-N.
| Molecular formula | C10H14BrNO2S |
|---|---|
| Molecular weight | 292.19 g/mol |
| IUPAC name | 3-bromo-N,N-diethylbenzenesulfonamide |
| InChIKey | ZELYQSZTABGDLA-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)