Products 1269233-13-7
CAS 1269233-13-7 is the registry number for N-(3-Bromo-5-methylphenyl)propane-2-sulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-(3-bromo-5-methylphenyl)propane-2-sulfonamide (CAS 1269233-13-7) is a chemical compound with the molecular formula C10H14BrNO2S and a molecular weight of 292.19 g/mol. IUPAC name: N-(3-bromo-5-methylphenyl)propane-2-sulfonamide. InChIKey: TYVZMDXOAAZCMM-UHFFFAOYSA-N.
| Molecular formula | C10H14BrNO2S |
|---|---|
| Molecular weight | 292.19 g/mol |
| IUPAC name | N-(3-bromo-5-methylphenyl)propane-2-sulfonamide |
| InChIKey | TYVZMDXOAAZCMM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)Br)NS(=O)(=O)C(C)C |
Computed by PubChem (NCBI)