CAS 871269-09-9 appears in our catalog under these names: N-Butyl 3-bromobenzenesulfonamide, 98%, N-Butyl 3-bromobenzenesulfonamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 25g, 500g, 5g, 100g, 1g, 2,5g.
3-bromo-N-butylbenzenesulfonamide (CAS 871269-09-9) is a chemical compound with the molecular formula C10H14BrNO2S and a molecular weight of 292.19 g/mol. IUPAC name: 3-bromo-N-butylbenzenesulfonamide. InChIKey: FOIGOOIJVWAXCR-UHFFFAOYSA-N.
| Molecular formula | C10H14BrNO2S |
|---|---|
| Molecular weight | 292.19 g/mol |
| IUPAC name | 3-bromo-N-butylbenzenesulfonamide |
| InChIKey | FOIGOOIJVWAXCR-UHFFFAOYSA-N |
| SMILES | CCCCNS(=O)(=O)C1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)